Isorhapontigenin (Standard) | CAS | 32507-66-7 |
| Molecular Weight | 258.27 |
| Formula | C15H14O4 |
| SMILES | OC1=CC(O)=CC(/C=C/C2=CC(OC)=C(O)C=C2)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13621 | Phytic Acid Sodium Salt | Inquiry |
|
| PDP-14209 | 9"-Methyl Salvianolate B | Inquiry |
|
| PDP-14697 | Nasunin | Inquiry |
|
| PDP-15593 | Gelsevirine | Inquiry |
|
| PDP-16526 | Nagilactone B | Inquiry |
|
| PDP-18523 | Isorhamnetin 7-O-α-L-rhamnoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
