Homoharringtonine | Synonyms | Omacetaxine Mepesuccinate; HHT |
| Appearance | Solid |
| CAS | 26833-87-4 |
| Purity | 99.96% |
| Molecular Weight | 545.62 |
| Formula | C29H39NO9 |
| Color | Off-white to yellow |
| SMILES | [H][C@@]12[C@](CCC3)(C=C(OC)[C@]2(OC([C@](CCCC(O)(C)C)(O)CC(OC)=O)=O)[H])N3CCC4=CC5=C(OCO5)C=C14 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 1 year; -20°C, 6 months (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13305 | Amentoflavone | Inquiry |
|
| PDP-15808 | Ursolic Acid (Standard) | Inquiry |
|
| PDP-17433 | 2-Desoxyflorilenalin-L-α-arabinopyranoside | Inquiry |
|
| PDP-13281 | Butylphthalide | Inquiry |
|
| PDP-15244 | Kadsurenone | Inquiry |
|
| PDP-18477 | Angelol B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
