Hydroxyvalerenic Acid (Standard) | CAS | 1619-16-5 |
| Molecular Weight | 250.33 |
| Formula | C15H22O3 |
| SMILES | O=C(O)/C(C)=C/[C@H]1C2=C(C)C[C@@H](O)[C@]2([H])[C@H](C)CC1 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16572 | Gymnestrogenin | Inquiry |
|
| PDP-18903 | Yadanziolide B | Inquiry |
|
| PDP-15231 | O-Desmethyl Galanthamine | Inquiry |
|
| PDP-16814 | Flazin | Inquiry |
|
| PDP-15366 | Incensole | Inquiry |
|
| PDP-18194 | Macrocarpal B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
