Inundoside E | CAS No. | 80244-83-3 |
| Molecular Weight | 574.83 |
| Formula | C35H58O6 |
| SMILES | C[C@@]12[C@]3([H])[C@](CC4=CC[C@](C(C)([C@@H](CC5)O)C)([H])[C@@]5(C)[C@@]4([H])CC3)(CC[C@@]1([H])C(C)([C@H](CC2)O[C@H]6[C@@H]([C@H]([C@H](CO6)O)O)O)C)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11523 | D-Tagatose | Inquiry |
|
| MDP-23751 | Noformicin | Inquiry |
|
| MDP-23220 | α-Terpineol (Standard) | Inquiry |
|
| MDP-24065 | Nanaomycin E | Inquiry |
|
| MDP-23821 | Chimeramycin B | Inquiry |
|
| MDP-22696 | 3,5-Dimethoxytoluene (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
