Ionomycin | CAS No. | 56092-81-0 |
| Purity | ≥99.0% |
| Synonyms | SQ23377 |
| Molecular Weight | 709.01 |
| Formula | C41H72O9 |
| Appearance | Liquid |
| Color | Colorless to light yellow |
| SMILES | O=C(O)CC[C@@H](C)C[C@H](C)C[C@H](C)C(/C=C(O)/[C@H](C)C[C@H](C)C/C=C/[C@@H](C)[C@@H](O)[C@@H](C)[C@@H](O)C[C@@H]1CC[C@]([C@@H]2O[C@](C)([C@H](O)C)CC2)(C)O1)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage | Solution, -20°C, 2 years |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22107 | Lamellarin E | Inquiry |
|
| MDP-23286 | Oxytetracycline (Standard) | Inquiry |
|
| MDP-22085 | Palmitoleoyl-CoA | Inquiry |
|
| MDP-12384 | NADPH (Standard) | Inquiry |
|
| MDP-22631 | Camalexin (Standard) | Inquiry |
|
| MDP-12543 | Virustomycin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
