Lamellarin E | CAS No. | 115982-19-9 |
| Molecular Weight | 531.51 |
| Formula | C29H25NO9 |
| SMILES | O=C1OC2=C(C3=C1N4CCC5=C(C=C(C(OC)=C5O)OC)C4=C3C6=CC=C(C(O)=C6)OC)C=C(OC)C(O)=C2 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11069 | Riboflavin | Inquiry |
|
| MDP-22750 | Cycloneroside B | Inquiry |
|
| MDP-11892 | Pseudouridimycin | Inquiry |
|
| MDP-24108 | Istamycin B | Inquiry |
|
| MDP-12541 | Tirandamycin A | Inquiry |
|
| MDP-22874 | Roridin H | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
