Isoescin Ie | CAS | 1613506-28-7 |
| Molecular Weight | 969.12 |
| Formula | C49H76O19 |
| SMILES | CC(OC[C@]([C@@H](C[C@]12C)O)([C@H]([C@@H]3OC(/C(C)=C/C)=O)O)[C@](CC3(C)C)([H])C1=CC[C@@]4([H])[C@]2(CC[C@]([C@](C)5CO)([H])[C@@]4(CC[C@@H]5O[C@H](O[C@@H]6C(O)=O)[C@@H]([C@H]([C@@H]6O)O)O[C@@H]([C@@H]([C@H]7O)O)O[C@@H]([C@H]7O)CO)C)C)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15270 | Noreugenin | Inquiry |
|
| PDP-17121 | (-)-Praeruptorin A | Inquiry |
|
| PDP-19589 | Eupalinilide B | Inquiry |
|
| PDP-19877 | Hastatoside (Standard) | Inquiry |
|
| PDP-18227 | Kelampayoside A | Inquiry |
|
| PDP-14616 | Ajmalicine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
