Isogosferol | Synonyms | (+)-Isogospherol; Isogospherol |
| CAS | 53319-52-1 |
| Molecular Weight | 286.28 |
| Formula | C16H14O5 |
| SMILES | CC([C@@H](O)COC1=C(OC=C2)C2=CC(C=C3)=C1OC3=O)=C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13284 | (Z)-Ligustilide | Inquiry |
|
| PDP-19093 | Vitedoin A | Inquiry |
|
| PDP-13755 | Plantainoside D | Inquiry |
|
| PDP-19624 | Kopsoffinol | Inquiry |
|
| PDP-19439 | Pyrroside B | Inquiry |
|
| PDP-14949 | Jatrorrhizine Hydroxide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
