Isorhapontin | Appearance | Solid |
| CAS | 32727-29-0 |
| Purity | 98.42% |
| Molecular Weight | 420.41 |
| Formula | C21H24O9 |
| Color | Yellow to brown |
| SMILES | OC[C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1OC2=CC(/C=C/C3=CC(OC)=C(C=C3)O)=CC(O)=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20056 | Capsaicin (Purity 65%) (Standard) | Inquiry |
|
| PDP-13411 | Bilobalide | Inquiry |
|
| PDP-16214 | Euphorbetin | Inquiry |
|
| PDP-18883 | Goshonoside F5 | Inquiry |
|
| PDP-18768 | Kushenol O | Inquiry |
|
| PDP-16171 | Nortanshinone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
