Jamaicin | CAS | 24211-36-7 |
| Molecular Weight | 378.37 |
| Formula | C22H18O6 |
| SMILES | O=C1C2=CC=C3C(C=CC(C)(C)O3)=C2OC=C1C4=C(OC)C=C(OCO5)C5=C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19474 | α-Spinasterol-3-O-β-D-glucoside | Inquiry |
|
| PDP-20002 | Cirsimarin (Standard) | Inquiry |
|
| PDP-15374 | Arjunolic Acid | Inquiry |
|
| PDP-15348 | Ganoderol B | Inquiry |
|
| PDP-14544 | Racanisodamine | Inquiry |
|
| PDP-20252 | Kmeriol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
