α-Spinasterol-3-O-β-D-glucoside | Synonyms | α-Spinasterol Glucoside |
| CAS | 1745-36-4 |
| Molecular Weight | 574.83 |
| Formula | C35H58O6 |
| SMILES | C[C@@]12[C@](CC[C@]2([H])[C@H](C)/C=C/[C@@H](CC)C(C)C)([H])C3=CC[C@](C[C@H](CC4)O[C@@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)CO)([H])[C@@]4(C)[C@@]3([H])CC1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13225 | Chrysin | Inquiry |
|
| PDP-18088 | Caesalmin B | Inquiry |
|
| PDP-20399 | Pulchinenoside B | Inquiry |
|
| PDP-14650 | Pulchinenoside A | Inquiry |
|
| PDP-16983 | Rutacridone | Inquiry |
|
| PDP-18312 | Demethoxydeacetoxypseudolaric Acid B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
