Janthinocin B | CAS No. | 131086-53-8 |
| Molecular Weight | 1191.33 |
| Formula | C57H82N12O16 |
| SMILES | NCCC[C@@H](NC1=O)C(N[C@H](C(O[C@H]([C@H](C(N[C@@H](C(N[C@@H](C(N[C@@H](C(N/C(C(N[C@H](CO)C(N/C1=C(O)/C2=CNC3=CC=CC=C32)=O)=O)=C/C)=O)[C@H](O)C(C)C)=O)CO)=O)[C@@H](O)C)=O)NC([C@H]([C@@H](C)CC)N)=O)C(C)C)=O)CC4=CC=CC=C4)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22211 | Germicidin B | Inquiry |
|
| MDP-23147 | Piericidin B | Inquiry |
|
| MDP-11368 | Adenosylcobalamin | Inquiry |
|
| MDP-21946 | (S)-1-(4-Hydroxyphenyl)ethane-1,2-diol | Inquiry |
|
| MDP-10940 | Melatonin | Inquiry |
|
| MDP-11974 | 1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
