Janthitrem F | CAS No. | 90986-52-0 |
| Molecular Weight | 645.82 |
| Formula | C39H51NO7 |
| SMILES | O[C@@]([C@@]1(C)[C@]23C)(C4=C[C@@H](OC(C)=O)[C@@H](C(C)(O)C)O[C@@]4([H])CC1)CC[C@@]2([H])CC5=C3NC6=C5C=C7C(C8=CC(C)(C)OC(C)(C)[C@@]8([H])[C@@H]7O)=C6 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11775 | Tosufloxacin Tosylate Hydrate | Inquiry |
|
| MDP-11637 | Pimelic Acid | Inquiry |
|
| MDP-22127 | Fosmidomycin | Inquiry |
|
| MDP-23895 | Seldomycin Factor 5 | Inquiry |
|
| MDP-23680 | Chrodrimanin B | Inquiry |
|
| MDP-10910 | Rapamycin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
