Centrolobol | CAS | 30359-01-4 |
| Molecular Weight | 300.39 |
| Formula | C19H24O3 |
| SMILES | OC(C=C1)=CC=C1CCCC[C@@H](O)CCC2=CC=C(O)C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18351 | Epicatechin Pentaacetate | Inquiry |
|
| PDP-17075 | Sonnerphenolic B | Inquiry |
|
| PDP-13890 | (-)-Alkannin | Inquiry |
|
| PDP-19251 | Astin B | Inquiry |
|
| PDP-15500 | Kobophenol A | Inquiry |
|
| PDP-19930 | Agnuside (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
