Jolkinolide B (Standard) | CAS | 37905-08-1 |
| Molecular Weight | 330.42 |
| Formula | C20H26O4 |
| SMILES | C[C@]([C@]1([H])CC2)(CCCC1(C)C)[C@@]([C@@H]3[C@@]4(O5)O3)([H])[C@@]62[C@@H](C4=C(C)C5=O)O6 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20401 | Galanthamine (hydrobromide) (Standard) | Inquiry |
|
| PDP-18694 | Serrin A | Inquiry |
|
| PDP-17322 | 1-Dehydro-[10]-gingerdione | Inquiry |
|
| PDP-19286 | 15-epi-Danshenol A | Inquiry |
|
| PDP-13946 | Demethyleneberberine Chloride | Inquiry |
|
| PDP-20205 | Spiraeoside (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
