Kaempferol 3-O-(2''-O-α-rhamnosyl-6''-O-malonyl-β-glucoside) | Appearance | Solid |
| CAS | 528606-92-0 |
| Molecular Weight | 680.56 |
| Formula | C30H32O18 |
| Color | Off-white to light yellow |
| SMILES | O=C(C(O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(CC(O)=O)=O)O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)O)O)O)=C(C3=CC=C(C=C3)O)OC4=CC(O)=C5)C4=C5O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17774 | PSX020 | Inquiry |
|
| PDP-19280 | Schiarisanrin B | Inquiry |
|
| PDP-17441 | Epicornuin F | Inquiry |
|
| PDP-15439 | Paederosidic Acid | Inquiry |
|
| PDP-17843 | Isovaleroyl Oxokadsuranol | Inquiry |
|
| PDP-20075 | 2'-Rhamnoechinacoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
