Kakkanin | Appearance | Solid |
| CAS | 63770-91-2 |
| Purity | 99.44% |
| Molecular Weight | 578.52 |
| Formula | C27H30O14 |
| Color | Off-white to light yellow |
| SMILES | O=C1C(C2=CC=C(OC)C=C2)=COC3=CC(O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O)O4)O)O)O)=CC(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15612 | Pasakbumin B | Inquiry |
|
| PDP-18620 | Glyasperin D | Inquiry |
|
| PDP-15432 | Rubiadin-1-methyl Ether | Inquiry |
|
| PDP-13335 | Galanthamine | Inquiry |
|
| PDP-18969 | 25-O-Methylcimigenol-3-O-D-xylopyranoside | Inquiry |
|
| PDP-19464 | Scillascillin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
