Kasugamycin Hydrochloride | CAS No. | 19408-46-9 |
| Purity | 99.44% |
| Synonyms | Ksg Hydrochloride |
| Molecular Weight | 415.82 |
| Formula | C14H26ClN3O9 |
| Appearance | Solid |
| Color | Off-white to light yellow |
| SMILES | OC(C(N[C@@H](C[C@@H]1N)[C@@H](C)O[C@]1([H])O[C@@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@H]2O)=N)=O.[H]Cl |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12581 | Amphotericin B Trihydrate | Inquiry |
|
| MDP-22779 | Adenosine 5'-diphosphoribose (Standard) | Inquiry |
|
| MDP-24132 | Cytochalasin F | Inquiry |
|
| MDP-12667 | Phaeosphaone D | Inquiry |
|
| MDP-22348 | Nigericin (sodium Salt) (Standard) | Inquiry |
|
| MDP-22091 | Jatrophone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.