Adenosine 5'-diphosphoribose (Standard) | CAS No. | 20762-30-5 |
| Synonyms | ADP Ribose (Standard) |
| Molecular Weight | 559.32 |
| Formula | C15H23N5O14P2 |
| SMILES | O[C@H]1[C@@H](O)[C@H](N2C=NC3=C2N=CN=C3N)O[C@@H]1COP(OP(OC[C@H]([C@H]([C@H](C=O)O)O)O)(O)=O)(O)=O |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11135 | Tacrolimus Monohydrate | Inquiry |
|
| MDP-22747 | Citraconic Acid (Standard) | Inquiry |
|
| MDP-24267 | Cytosaminomycin C | Inquiry |
|
| MDP-23417 | Bagougeramine B | Inquiry |
|
| MDP-12716 | Psoracorylifol B | Inquiry |
|
| MDP-23567 | Hericenone J | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
