Kerriamycin C | CAS No. | 98495-38-6 |
| Molecular Weight | 730.75 |
| Formula | C37H46O15 |
| SMILES | O[C@@]12C3=C(C=C[C@@]1(C[C@@](O)(CC2=O)C)O)C(C4=C(O)C([C@H]5C[C@H]([C@@H]([C@H](O5)C)O)O[C@@H]6O[C@H]([C@H](CC6)O[C@H]7C[C@H]([C@@H]([C@H](O7)C)O)O)C)=CC=C4C3=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22514 | Cytochalasin B (Standard) | Inquiry |
|
| MDP-24204 | Grahamimycin B | Inquiry |
|
| MDP-11212 | Thiamine Pyrophosphate | Inquiry |
|
| MDP-12135 | Gentisyl Alcohol | Inquiry |
|
| MDP-21969 | Methyl Ganoderic Acid B | Inquiry |
|
| MDP-11260 | Nalidixic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
