Khellin | Appearance | Solid |
| CAS | 82-02-0 |
| Purity | 99.89% |
| Molecular Weight | 260.24 |
| Formula | C14H12O5 |
| Color | White to light yellow |
| SMILES | O=C1C=C(C)OC2=C(OC)C(OC=C3)=C3C(OC)=C12 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15480 | Pilloin | Inquiry |
|
| PDP-19003 | Vernolide B | Inquiry |
|
| PDP-18767 | Citrusinol | Inquiry |
|
| PDP-18806 | Isoanthricin | Inquiry |
|
| PDP-18597 | 10-Isobutyryloxy-8,9-epoxythymol Isobutyrate | Inquiry |
|
| PDP-14336 | Secoxyloganin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
