Kibdelone A | CAS No. | 934464-77-4 |
| Molecular Weight | 581.95 |
| Formula | C29H24ClNO10 |
| SMILES | OC1=C(C(C2=C([C@H](C[C@@H]([C@@H]2O)O)O)O3)=O)C3=C(OC)C4=CC=C(C(C5=C(C(N(C(CCC)=C5Cl)C)=O)C6=O)=O)C6=C14 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23980 | Saframycin G | Inquiry |
|
| MDP-22703 | 2-Acetylpyrrole (Standard) | Inquiry |
|
| MDP-22394 | Bilirubin Diglucuronide | Inquiry |
|
| MDP-23785 | Chrysospermin B | Inquiry |
|
| MDP-24386 | Gibepyrone D | Inquiry |
|
| MDP-22516 | 9-Dehydroxyeurotinone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
