Kukoamine A | Appearance | Solid |
| CAS | 75288-96-9 |
| Purity | 99.88% |
| Molecular Weight | 530.66 |
| Formula | C28H42N4O6 |
| Color | White to off-white |
| SMILES | O=C(NCCCNCCCCNCCCNC(CCC1=CC=C(O)C(O)=C1)=O)CCC2=CC=C(O)C(O)=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14559 | Saponarin | Inquiry |
|
| PDP-18872 | Nepetoidin B | Inquiry |
|
| PDP-13376 | 1-Deoxynojirimycin | Inquiry |
|
| PDP-20557 | Ginkgolide B (Standard) | Inquiry |
|
| PDP-17525 | Inuviscolide | Inquiry |
|
| PDP-18419 | Iriflophenone 2-O-α-rhamnoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
