Kuwanon B | CAS | 62949-78-4 |
| Molecular Weight | 420.45 |
| Formula | C25H24O6 |
| SMILES | O=C1C(C/C=C(C)\C)=C(C2=CC=C3C(C=CC(C)(C)O3)=C2O)OC4=CC(O)=CC(O)=C14 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15110 | (-)-(E)-Guggulsterone | Inquiry |
|
| PDP-20080 | Apoatropine | Inquiry |
|
| PDP-18906 | 4-O-Methylbutein | Inquiry |
|
| PDP-16914 | Macranthoside A | Inquiry |
|
| PDP-19332 | Precyasterone | Inquiry |
|
| PDP-13468 | Procyanidin B1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
