L-Carnosine (Standard) | CAS No. | 305-84-0 |
| Molecular Weight | 226.23 |
| Formula | C9H14N4O3 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | OC([C@@H](NC(CCN)=O)CC1=CN=CN1)=O |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22761 | 3-Hydroxyisovalerylcarnitine (Standard) | Inquiry |
|
| MDP-12209 | Cecropin A TFA | Inquiry |
|
| MDP-12628 | Thielavin B | Inquiry |
|
| MDP-23690 | Lanopylin B1 | Inquiry |
|
| MDP-24004 | Chandrananimycin B | Inquiry |
|
| MDP-12784 | 3-Acetyldeoxynivalenol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
