L-Tyrosine | CAS No. | 60-18-4 |
| Purity | 98.73% |
| Synonyms | Tyrosine |
| Molecular Weight | 181.19 |
| Formula | C9H11NO3 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | N[C@@H](CC1=CC=C(C=C1)O)C(O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23744 | Hydroxyakalone | Inquiry |
|
| MDP-23787 | Marcellomycin | Inquiry |
|
| MDP-23929 | Cytosporin B | Inquiry |
|
| MDP-23575 | Sannamycin E | Inquiry |
|
| MDP-12218 | Herbimycin A | Inquiry |
|
| MDP-23459 | Arisostatin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
