Lateropyrone | CAS No. | 93752-78-4 |
| Molecular Weight | 318.24 |
| Formula | C15H10O8 |
| SMILES | O=C(C(O1)=C(O)C2=C(C1=O)C(O)=C(C(C=C(C)O3)=O)C3=C2)OC |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12210 | Neosartoricin B | Inquiry |
|
| MDP-12767 | Ergosta-7,22-dien-3-one | Inquiry |
|
| MDP-22795 | Leucinostatin K | Inquiry |
|
| MDP-24066 | Erythroskyrine | Inquiry |
|
| MDP-23147 | Piericidin B | Inquiry |
|
| MDP-22030 | Chloramphenicol Succinate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
