Linarin | Synonyms | Buddleoside; Linarine |
| Appearance | Solid |
| CAS | 480-36-4 |
| Purity | 98.00% |
| Molecular Weight | 592.55 |
| Formula | C28H32O14 |
| Color | White to off-white |
| SMILES | O=C(C=C(C1=CC=C(OC)C=C1)OC2=CC(O[C@@H]([C@@H]([C@@H](O)[C@@H]3O)O)O[C@@H]3CO[C@H](O[C@@H](C)[C@H](O)[C@H]4O)[C@@H]4O)=C5)C2=C5O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18564 | Thalrugosaminine | Inquiry |
|
| PDP-15684 | 4-Methoxycinnamaldehyde | Inquiry |
|
| PDP-19719 | Forsythiaside A (Standard) | Inquiry |
|
| PDP-18481 | Perisesaccharide B | Inquiry |
|
| PDP-19235 | Vibsanin C | Inquiry |
|
| PDP-19468 | 2"-O-Coumaroyljuglanin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
