Lobophorin CR-2 | CAS No. | 1800562-59-7 |
| Molecular Weight | 1203.37 |
| Formula | C61H90N2O22 |
| SMILES | OC([C@@]12[C@@](/C=C([C@H](CC(C([C@@]3([H])[C@@]4([C@@]5([H])[C@@](C=C3)([H])[C@H]([C@H](C[C@@H]5C)C)O[C@H]6C[C@H]([C@H]([C@@H](O6)C)O)O[C@H]7C[C@H]([C@H]([C@@H](O7)C)O[C@@H]8C[C@H]([C@H]([C@@H](O8)C)OC)O)O)C)=C)O)O[C@H]9C[C@@](C)([C@H]([C@H](O9)C)NC(OC)=O)[N+]([O-])=O)\C)([H])C=C([C@@H](C1)C)CO)=C(C(O2)=O)C4=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23312 | Chlortetracycline (hydrochloride) (Standard) | Inquiry |
|
| MDP-11972 | Peonidin Chloride | Inquiry |
|
| MDP-22203 | Dopamine (hydrochloride) (Standard) | Inquiry |
|
| MDP-23941 | Halomicin A | Inquiry |
|
| MDP-11320 | Maleimide | Inquiry |
|
| MDP-24204 | Grahamimycin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
