(+)-Magnoflorine Iodide | Synonyms | Magnoflorine Iodide; α-Magnoflorine Iodide; Thalictrine Iodide |
| Appearance | Solid |
| CAS | 4277-43-4 |
| Purity | 99.69% |
| Molecular Weight | 469.31 |
| Formula | C20H24INO4 |
| Color | White to light yellow |
| SMILES | C[N+]1(C)CCC2=CC(OC)=C(O)C3=C2[C@]1([H])CC4=CC=C(OC)C(O)=C34.[I-] |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15861 | Yunaconitine | Inquiry |
|
| PDP-13887 | (E)-Cardamonin | Inquiry |
|
| PDP-18674 | Taxuspine B | Inquiry |
|
| PDP-13912 | Harmane | Inquiry |
|
| PDP-18143 | Nb-Demethylechitamine | Inquiry |
|
| PDP-16727 | Methyl 3-hydroxy-4,5-dimethoxybenzoate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
