Taxuspine B | CAS | 157414-05-6 |
| Molecular Weight | 622.70 |
| Formula | C35H42O10 |
| SMILES | O=C(O[C@@H](C[C@H](OC(C)=O)[C@]1(C)C/2)C2=C\[C@H](OC(C)=O)[C@](C3(C)C)([H])C[C@H](OC(C)=O)C(C)=C3[C@@H](O)C1=O)/C=C/C4=CC=CC=C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13746 | Sophoraflavanone G | Inquiry |
|
| PDP-20004 | Protoescigenin (Standard) | Inquiry |
|
| PDP-14071 | Liquiritin Apioside | Inquiry |
|
| PDP-19805 | Schisantherin A (Standard) | Inquiry |
|
| PDP-19855 | Vincetoxicoside B (Standard) | Inquiry |
|
| PDP-17664 | Eudebeiolide B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
