Melithiazole C | CAS No. | 214420-47-0 |
| Molecular Weight | 339.41 |
| Formula | C16H21NO5S |
| SMILES | CC(C1=NC(/C=C/[C@H](OC)[C@@H](C)/C(OC)=C\C(OC)=O)=CS1)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22179 | Avenaciolide | Inquiry |
|
| MDP-23616 | Dermostatin B | Inquiry |
|
| MDP-21923 | Alterlactone | Inquiry |
|
| MDP-22914 | Hatomamicin | Inquiry |
|
| MDP-22803 | Harzianol A | Inquiry |
|
| MDP-23430 | Argyrin F | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
