Methyl 3-O-feruloylquinate | CAS | 154418-15-2 |
| Molecular Weight | 382.36 |
| Formula | C18H22O9 |
| SMILES | O=C([C@]1(O)C[C@@H](O)[C@@H](O)[C@H](OC(/C=C/C2=CC=C(O)C(OC)=C2)=O)C1)OC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16994 | Isogambogic Acid | Inquiry |
|
| PDP-17309 | Angulatin B | Inquiry |
|
| PDP-17508 | Isocucurbitacin D | Inquiry |
|
| PDP-20197 | Liriopesides B (Standard) | Inquiry |
|
| PDP-18389 | Gardneramine | Inquiry |
|
| PDP-17100 | Garcinone B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
