Methyl P-coumarate | Synonyms | Methyl 4-hydroxycinnamate |
| Appearance | Solid |
| CAS | 3943-97-3 |
| Purity | 99.80% |
| Molecular Weight | 178.18 |
| Formula | C10H10O3 |
| Color | Off-white to light yellow |
| SMILES | O=C(OC)/C=C/C1=CC=C(O)C=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17581 | 2-Hydroxypinocembrin | Inquiry |
|
| PDP-18161 | Mirabijalone D | Inquiry |
|
| PDP-18727 | 8-Methyl Chrysophanol | Inquiry |
|
| PDP-16451 | (-)-Epicatechin Gallate (Standard) | Inquiry |
|
| PDP-19672 | Pinosylvin (Standard) | Inquiry |
|
| PDP-19747 | Momordin Ic (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
