Micromelin | Synonyms | Micromelumin |
| CAS | 15085-71-9 |
| Molecular Weight | 288.25 |
| Formula | C15H12O6 |
| SMILES | C[C@]12[C@](O2)([H])[C@@](C(C=C(C=CC3=O)C(O3)=C4)=C4OC)([H])OC1=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15626 | Veratrosine | Inquiry |
|
| PDP-17414 | Broussonol E | Inquiry |
|
| PDP-17990 | Ganolactone B | Inquiry |
|
| PDP-13796 | Solanesol | Inquiry |
|
| PDP-16250 | 1-Methoxyphaseollidin | Inquiry |
|
| PDP-18908 | Hispanone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
