Migrastatin | CAS No. | 314245-65-3 |
| Molecular Weight | 489.60 |
| Formula | C27H39NO7 |
| SMILES | O=C(NC(C1)=O)CC1CCCC([C@H]([C@]2([H])/C(C)=C\[C@H]([C@@H]([C@H](/C=C/CC/C=C/C(O2)=O)OC)O)C)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23147 | Piericidin B | Inquiry |
|
| MDP-11803 | N-(3-Oxotetradecanoyl)-DL-homoserine Lactone | Inquiry |
|
| MDP-12671 | Cytochalasin K | Inquiry |
|
| MDP-12196 | HEX3 | Inquiry |
|
| MDP-23601 | Eurystatin A | Inquiry |
|
| MDP-21906 | Prehelminthosporol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
