Montixanthone | CAS | 876305-36-1 |
| Molecular Weight | 274.23 |
| Formula | C14H10O6 |
| SMILES | O=C1C2=CC(O)=C(C=C2OC3=CC(O)=CC(OC)=C13)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14058 | Betulinaldehyde | Inquiry |
|
| PDP-18791 | Pratensein-7-O-β-D-glucopyranoside | Inquiry |
|
| PDP-15251 | Thevetin B | Inquiry |
|
| PDP-14089 | Yakuchinone A | Inquiry |
|
| PDP-17976 | 3-O-Methylquercetin Tetraacetate | Inquiry |
|
| PDP-15461 | Viscumneoside III | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
