Viscumneoside III | Appearance | Solid |
| CAS | 118985-27-6 |
| Purity | 98.74% |
| Molecular Weight | 596.53 |
| Formula | C27H32O15 |
| Color | Off-white to light yellow |
| SMILES | O=C1C2=C(O)C=C(O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O[C@@]4([H])[C@@H]([C@](O)(CO4)CO)O)C=C2O[C@H](C5=CC(OC)=C(C=C5)O)C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16316 | (2S)-2'-Methoxykurarinone | Inquiry |
|
| PDP-18574 | Arvenin I | Inquiry |
|
| PDP-13687 | Ganoderic Acid D | Inquiry |
|
| PDP-13842 | Isorhynchophylline | Inquiry |
|
| PDP-15533 | trans-Melilotoside | Inquiry |
|
| PDP-19778 | Calceolarioside B (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
