Murrayanol | CAS | 144525-81-5 |
| Molecular Weight | 363.49 |
| Formula | C24H29NO2 |
| SMILES | OC1=C(C/C=C(C)/CC/C=C(C)\C)C(NC2=C3C=C(C)C(OC)=C2)=C3C=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16937 | Maohuoside B | Inquiry |
|
| PDP-20180 | Crassicauline A (Standard) | Inquiry |
|
| PDP-19705 | Derwentioside B | Inquiry |
|
| PDP-18120 | Olivil Monoacetate | Inquiry |
|
| PDP-13862 | Soyasapogenol B | Inquiry |
|
| PDP-15466 | Methyl Arachidate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
