Myricetin 3-O-glucoside | CAS No. | 19833-12-6 |
| Purity | ≥99.0% |
| Synonyms | Myricetin 3-β-D-glucopyranoside |
| Molecular Weight | 480.38 |
| Formula | C21H20O13 |
| Appearance | Solid |
| Color | Light yellow to yellow |
| SMILES | O=C1C(O[C@@H]([C@@H]([C@H]2O)O)O[C@@H]([C@H]2O)CO)=C(C(C=C3O)=CC(O)=C3O)OC4=CC(O)=CC(O)=C14 |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12316 | Gilvocarcin V | Inquiry |
|
| MDP-23163 | Paraxanthine (Standard) | Inquiry |
|
| MDP-22405 | 20β-22-Azacholesterol | Inquiry |
|
| MDP-23821 | Chimeramycin B | Inquiry |
|
| MDP-24157 | Citreamicin γ | Inquiry |
|
| MDP-22707 | 3-Methoxyphenylacetic Acid (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
