N-(3-Phenylpropanoyl)pyrrole | CAS | 112448-69-8 |
| Molecular Weight | 199.25 |
| Formula | C13H13NO |
| SMILES | O=C(N1C=CC=C1)CCC2=CC=CC=C2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15015 | 6-Methoxydihydrosanguinarine | Inquiry |
|
| PDP-16928 | Triphala | Inquiry |
|
| PDP-18251 | Isodihydrofutoquinol B | Inquiry |
|
| PDP-18797 | 2-Hydroxy-1-Methoxyaporphine | Inquiry |
|
| PDP-15433 | (2S,3R,4S)-4-Hydroxyisoleucine | Inquiry |
|
| PDP-15111 | Licoricidin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
