Napsamycin C | CAS No. | 144379-26-0 |
| Molecular Weight | 854.93 |
| Formula | C39H50N8O12S |
| SMILES | O=C(C(CC1=CC(O)=CC=C1)NC(NC(CCSC)C(NC(C(C)N(C)C(C2NCC3=CC=C(C=C3C2)O)=O)C(N/C=C4OC(C(C/4)O)N5C(NC(CC5)=O)=O)=O)=O)=O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24163 | Halomicin B | Inquiry |
|
| MDP-24029 | Kibdelin C1 | Inquiry |
|
| MDP-22286 | Carglumic Acid (Standard) | Inquiry |
|
| MDP-12087 | 2,4-Di-tert-butylphenol (Standard) | Inquiry |
|
| MDP-11615 | Ikarugamycin | Inquiry |
|
| MDP-10992 | Kifunensine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
