Neopuerarin B | CAS | 1150314-39-8 |
| Molecular Weight | 416.38 |
| Formula | C21H20O9 |
| SMILES | O=C1C(C2=CC=C(O)C=C2)=COC3=C([C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O)O4)O)O)C(O)=CC=C13 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15841 | Fuziline | Inquiry |
|
| PDP-20521 | Cynaroside (Standard) | Inquiry |
|
| PDP-15292 | Mauritianin | Inquiry |
|
| PDP-14085 | Salvinorin B | Inquiry |
|
| PDP-14828 | α-Angelica Lactone | Inquiry |
|
| PDP-15007 | Ginsenoside Rk2 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
