Neritaloside | CAS | 465-13-4 |
| Molecular Weight | 592.72 |
| Formula | C32H48O10 |
| SMILES | C[C@]([C@](C(CO1)=CC1=O)([H])[C@H]2OC(C)=O)(CC[C@@]3([H])[C@@]4([H])CC[C@@](C5)([H])[C@@]3(CC[C@@H]5O[C@H](O[C@@H]6C)[C@@H]([C@H]([C@H]6O)OC)O)C)[C@@]4(C2)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15996 | Otophylloside B | Inquiry |
|
| PDP-19139 | Girinimbine | Inquiry |
|
| PDP-14011 | Mesaconitine | Inquiry |
|
| PDP-16655 | Pinolenic Acid | Inquiry |
|
| PDP-18630 | 12-Hydroxyganoderic Acid D | Inquiry |
|
| PDP-18666 | (±)-Isomenthone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
