Niazinin | Appearance | Solid |
| CAS | 147821-57-6 |
| Purity | 99.94% |
| Molecular Weight | 343.40 |
| Formula | C15H21NO6S |
| Color | Off-white to light yellow |
| SMILES | O[C@H]([C@@H]([C@H]([C@@H](O1)C)O)O)[C@@H]1OC2=CC=C(C=C2)CNC(OC)=S |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20542 | Jujuboside B (Standard) | Inquiry |
|
| PDP-15250 | cis-Ferulic Acid 4-O-β-D-glucopyranoside | Inquiry |
|
| PDP-15515 | Diosbulbin B | Inquiry |
|
| PDP-16251 | Eicosyl Ferulate | Inquiry |
|
| PDP-18040 | 10-Carboxylinalool | Inquiry |
|
| PDP-19979 | Armepavine (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
