Isoacteoside | Synonyms | Isoverbascoside |
| Appearance | Solid |
| CAS | 61303-13-7 |
| Purity | 99.73% |
| Molecular Weight | 624.59 |
| Formula | C29H36O15 |
| Color | White to yellow |
| SMILES | OC1=CC(/C=C/C(OC[C@@H]2[C@@H](O)[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](OCCC4=CC=C(O)C(O)=C4)O2)=O)=CC=C1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18677 | Taxuspine W | Inquiry |
|
| PDP-18404 | Goniodiol | Inquiry |
|
| PDP-20062 | Indigo (Standard) | Inquiry |
|
| PDP-18896 | Carpinontriol B | Inquiry |
|
| PDP-19042 | 6-Prenylquercetin-3-Me Ether | Inquiry |
|
| PDP-13541 | Parishin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
