Octahydrocurcumin | Synonyms | Hexahydrobisdemethoxycurcumin |
| Appearance | Oil |
| CAS | 36062-07-4 |
| Purity | 99.00% |
| Molecular Weight | 376.44 |
| Formula | C21H28O6 |
| Color | Light yellow to yellow |
| SMILES | OC(CC(O)CCC1=CC=C(O)C(OC)=C1)CCC2=CC=C(O)C(OC)=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Pure form -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17910 | Seneciphyllinine | Inquiry |
|
| PDP-17529 | Umuhengerin | Inquiry |
|
| PDP-13863 | N-trans-Feruloyltyramine | Inquiry |
|
| PDP-17229 | Aloenin B | Inquiry |
|
| PDP-16293 | Ethyl Orsellinate | Inquiry |
|
| PDP-15561 | Isomucronulatol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
