Oleocanthal | Appearance | Solid |
| CAS | 289030-99-5 |
| Purity | ≥99.0% |
| Molecular Weight | 304.34 |
| Formula | C17H20O5 |
| Color | White to off-white |
| SMILES | C/C=C([C@H](CC(OCCC1=CC=C(C=C1)O)=O)CC=O)/C=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14678 | Ginsenoside Ra1 | Inquiry |
|
| PDP-17981 | Ligupurpuroside B | Inquiry |
|
| PDP-15066 | Pedaliin | Inquiry |
|
| PDP-13490 | Sinapinic Acid | Inquiry |
|
| PDP-15381 | Macranthoidin B | Inquiry |
|
| PDP-19983 | Crocetin Monomethyl Ester (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
