Ovatodiolide | CAS | 3484-37-5 |
| Molecular Weight | 328.40 |
| Formula | C20H24O4 |
| SMILES | C=C1[C@@]2([H])[C@](/C=C(C[C@@]3([H])C=C(CC/C=C(CC2)\C)C(O3)=O)\C)([H])OC1=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16061 | Lindleyin | Inquiry |
|
| PDP-16507 | Phellodendron Amurense Extract | Inquiry |
|
| PDP-18291 | Coronarin D | Inquiry |
|
| PDP-15433 | (2S,3R,4S)-4-Hydroxyisoleucine | Inquiry |
|
| PDP-15349 | Vanicoside B | Inquiry |
|
| PDP-16874 | Diacetylpiptocarphol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
