Oxymatrine | Appearance | Solid |
| CAS | 16837-52-8 |
| Purity | 99.68% |
| Molecular Weight | 264.37 |
| Formula | C15H24N2O2 |
| Color | White to off-white |
| SMILES | O=C1CCC[C@]2([H])[C@@]3([H])CCC[N@@+]4([O-])[C@@]3([H])[C@](CCC4)([H])CN21 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18132 | N-Methylflindersine | Inquiry |
|
| PDP-18030 | 5-Heptadec-cis-8-enylresorcinol | Inquiry |
|
| PDP-17869 | C-2'-Decoumaroylaloeresin G | Inquiry |
|
| PDP-16471 | Crocin (Standard) | Inquiry |
|
| PDP-16987 | cis-Clovamide | Inquiry |
|
| PDP-18103 | Pierreione B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
